C24H31N5O5 — CID 144657638
(2Z)-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]-2-[2-(diethylamino)-2-oxoethoxy]iminoacetic acid (PubChem CID 144657638) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (2Z)-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]-2-[2-(diethylamino)-2-oxoethoxy]iminoacetic acid.
| Compound Name | (2Z)-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]-2-[2-(diethylamino)-2-oxoethoxy]iminoacetic acid |
|---|---|
| PubChem CID | 144657638 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (2Z)-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]-2-[2-(diethylamino)-2-oxoethoxy]iminoacetic acid |
| SMILES | CCN(CC)C(=O)CO/N=C(\C(=O)O)c1nc2ccccc2n(C2CC3CCCC(C2)N3)c1=O |
| InChI | InChI=1S/C24H31N5O5/c1-3-28(4-2)20(30)14-34-27-22(24(32)33)21-23(31)29(19-11-6-5-10-18(19)26-21)17-12-15-8-7-9-16(13-17)25-15/h5-6,10-11,15-17,25H,3-4,7-9,12-14H2,1-2H3,(H,32,33)/b27-22- |
| InChIKey | XWUSKADVGZDYKX-QYQHSDTDSA-N |
| XLogP | 1.92 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|