C23H31N5O4 — CID 144657738
(2Z)-2-(1-amino-3-methylbutan-2-yl)oxyimino-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]acetic acid (PubChem CID 144657738) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2Z)-2-(1-amino-3-methylbutan-2-yl)oxyimino-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]acetic acid.
| Compound Name | (2Z)-2-(1-amino-3-methylbutan-2-yl)oxyimino-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]acetic acid |
|---|---|
| PubChem CID | 144657738 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (2Z)-2-(1-amino-3-methylbutan-2-yl)oxyimino-2-[4-(9-azabicyclo[3.3.1]nonan-3-yl)-3-oxoquinoxalin-2-yl]acetic acid |
| SMILES | CC(C)C(CN)O/N=C(\C(=O)O)c1nc2ccccc2n(C2CC3CCCC(C2)N3)c1=O |
| InChI | InChI=1S/C23H31N5O4/c1-13(2)19(12-24)32-27-21(23(30)31)20-22(29)28(18-9-4-3-8-17(18)26-20)16-10-14-6-5-7-15(11-16)25-14/h3-4,8-9,13-16,19,25H,5-7,10-12,24H2,1-2H3,(H,30,31)/b27-21- |
| InChIKey | AHOPRYNIMMKQBX-MEFGMAGPSA-N |
| XLogP | 2.03 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|