C19H23FN2O4S2 — CID 144667429
2-acetamido-3-[[(3Z)-1-[(2-fluorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]disulfanyl]propanoic acid (PubChem CID 144667429) has the molecular formula C19H23FN2O4S2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-acetamido-3-[[(3Z)-1-[(2-fluorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]disulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[(3Z)-1-[(2-fluorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 144667429 |
| Molecular Formula | C19H23FN2O4S2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-acetamido-3-[[(3Z)-1-[(2-fluorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]disulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSSC1CCN(Cc2ccccc2F)C/C1=C/C=O)C(=O)O |
| InChI | InChI=1S/C19H23FN2O4S2/c1-13(24)21-17(19(25)26)12-27-28-18-6-8-22(11-15(18)7-9-23)10-14-4-2-3-5-16(14)20/h2-5,7,9,17-18H,6,8,10-12H2,1H3,(H,21,24)(H,25,26)/b15-7- |
| InChIKey | ZMINBDVWSHFHIJ-CHHVJCJISA-N |
| XLogP | 2.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|