C14H15FN2O3 — CID 170553018
(2Z)-2-[1-[(2-fluorophenyl)methyl]-4-nitrosopiperidin-3-ylidene]acetic acid (PubChem CID 170553018) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is (2Z)-2-[1-[(2-fluorophenyl)methyl]-4-nitrosopiperidin-3-ylidene]acetic acid.
| Compound Name | (2Z)-2-[1-[(2-fluorophenyl)methyl]-4-nitrosopiperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 170553018 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2Z)-2-[1-[(2-fluorophenyl)methyl]-4-nitrosopiperidin-3-ylidene]acetic acid |
| SMILES | O=NC1CCN(Cc2ccccc2F)C/C1=C/C(=O)O |
| InChI | InChI=1S/C14H15FN2O3/c15-12-4-2-1-3-10(12)8-17-6-5-13(16-20)11(9-17)7-14(18)19/h1-4,7,13H,5-6,8-9H2,(H,18,19)/b11-7- |
| InChIKey | ICGDPACOQBPUSK-XFFZJAGNSA-N |
| XLogP | 2.18 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|