C20H26ClNO5S — CID 169107191
(2E)-2-[1-[(2-chlorophenyl)methyl]-4-(1-propan-2-yloxycarbonyloxyethylsulfanyl)piperidin-3-ylidene]acetic acid (PubChem CID 169107191) has the molecular formula C20H26ClNO5S and a molecular weight of 427.95 g/mol. Its IUPAC name is (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(1-propan-2-yloxycarbonyloxyethylsulfanyl)piperidin-3-ylidene]acetic acid.
| Compound Name | (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(1-propan-2-yloxycarbonyloxyethylsulfanyl)piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 169107191 |
| Molecular Formula | C20H26ClNO5S |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(1-propan-2-yloxycarbonyloxyethylsulfanyl)piperidin-3-ylidene]acetic acid |
| SMILES | CC(C)OC(=O)OC(C)SC1CCN(Cc2ccccc2Cl)C/C1=C\C(=O)O |
| InChI | InChI=1S/C20H26ClNO5S/c1-13(2)26-20(25)27-14(3)28-18-8-9-22(12-16(18)10-19(23)24)11-15-6-4-5-7-17(15)21/h4-7,10,13-14,18H,8-9,11-12H2,1-3H3,(H,23,24)/b16-10+ |
| InChIKey | UFXASGWVPZYXLY-MHWRWJLKSA-N |
| XLogP | 4.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|