C19H25ClN2O6S — CID 169107203
(2E)-2-[1-[(2-chlorophenyl)methyl]-4-(methylcarbamoyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid;methyl formate (PubChem CID 169107203) has the molecular formula C19H25ClN2O6S and a molecular weight of 444.94 g/mol. Its IUPAC name is (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(methylcarbamoyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid;methyl formate.
| Compound Name | (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(methylcarbamoyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid;methyl formate |
|---|---|
| PubChem CID | 169107203 |
| Molecular Formula | C19H25ClN2O6S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (2E)-2-[1-[(2-chlorophenyl)methyl]-4-(methylcarbamoyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid;methyl formate |
| SMILES | CNC(=O)OCSC1CCN(Cc2ccccc2Cl)C/C1=C\C(=O)O.COC=O |
| InChI | InChI=1S/C17H21ClN2O4S.C2H4O2/c1-19-17(23)24-11-25-15-6-7-20(10-13(15)8-16(21)22)9-12-4-2-3-5-14(12)18;1-4-2-3/h2-5,8,15H,6-7,9-11H2,1H3,(H,19,23)(H,21,22);2H,1H3/b13-8+; |
| InChIKey | HEOZNFJAYFEHEN-FNXZNAJJSA-N |
| XLogP | 2.76 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|