C23H34ClNO6S — CID 169107194
[(3Z)-1-[(2-chlorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]sulfanylmethyl 2,2-dimethylpropanoate;methanol;methyl formate (PubChem CID 169107194) has the molecular formula C23H34ClNO6S and a molecular weight of 488.05 g/mol. Its IUPAC name is [(3Z)-1-[(2-chlorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]sulfanylmethyl 2,2-dimethylpropanoate;methanol;methyl formate.
| Compound Name | [(3Z)-1-[(2-chlorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]sulfanylmethyl 2,2-dimethylpropanoate;methanol;methyl formate |
|---|---|
| PubChem CID | 169107194 |
| Molecular Formula | C23H34ClNO6S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [(3Z)-1-[(2-chlorophenyl)methyl]-3-(2-oxoethylidene)piperidin-4-yl]sulfanylmethyl 2,2-dimethylpropanoate;methanol;methyl formate |
| SMILES | CC(C)(C)C(=O)OCSC1CCN(Cc2ccccc2Cl)C/C1=C/C=O.CO.COC=O |
| InChI | InChI=1S/C20H26ClNO3S.C2H4O2.CH4O/c1-20(2,3)19(24)25-14-26-18-8-10-22(13-16(18)9-11-23)12-15-6-4-5-7-17(15)21;1-4-2-3;1-2/h4-7,9,11,18H,8,10,12-14H2,1-3H3;2H,1H3;2H,1H3/b16-9-;; |
| InChIKey | JCXORLRZPJDWPZ-ULPVBNQHSA-N |
| XLogP | 3.72 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|