C15H18N2 — CID 144676266
2,7-dimethyl-3,4-dihydrofluorene-9,9-diamine (PubChem CID 144676266) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,7-dimethyl-3,4-dihydrofluorene-9,9-diamine.
| Compound Name | 2,7-dimethyl-3,4-dihydrofluorene-9,9-diamine |
|---|---|
| PubChem CID | 144676266 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2,7-dimethyl-3,4-dihydrofluorene-9,9-diamine |
| SMILES | CC1=CC2=C(CC1)c1ccc(C)cc1C2(N)N |
| InChI | InChI=1S/C15H18N2/c1-9-3-5-11-12-6-4-10(2)8-14(12)15(16,17)13(11)7-9/h3,5,7-8H,4,6,16-17H2,1-2H3 |
| InChIKey | GESWAIRXYKKUPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|