C17H23NS — CID 144676396
N-[(Z)-2-methylsulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]methanimine;prop-1-ene (PubChem CID 144676396) has the molecular formula C17H23NS and a molecular weight of 273.45 g/mol. Its IUPAC name is N-[(Z)-2-methylsulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]methanimine;prop-1-ene.
| Compound Name | N-[(Z)-2-methylsulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]methanimine;prop-1-ene |
|---|---|
| PubChem CID | 144676396 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[(Z)-2-methylsulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]methanimine;prop-1-ene |
| SMILES | C=CC.C=N/C(=C\SC)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H17NS.C3H6/c1-15-14(10-16-2)13-8-7-11-5-3-4-6-12(11)9-13;1-3-2/h7-10H,1,3-6H2,2H3;3H,1H2,2H3/b14-10-; |
| InChIKey | BFLXLSOSWQKPML-DZOOLQPHSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|