C24H32O5 — CID 144683145
ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-7-(3,4,5-trimethoxyphenyl)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 144683145) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-7-(3,4,5-trimethoxyphenyl)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-7-(3,4,5-trimethoxyphenyl)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 144683145 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-7-(3,4,5-trimethoxyphenyl)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C=CC1=C(/C=C\C)CC2COC(=O)C2C1c1cc(OC)c(OC)c(OC)c1.CC |
| InChI | InChI=1S/C22H26O5.C2H6/c1-6-8-13-9-15-12-27-22(23)20(15)19(16(13)7-2)14-10-17(24-3)21(26-5)18(11-14)25-4;1-2/h6-8,10-11,15,19-20H,2,9,12H2,1,3-5H3;1-2H3/b8-6-; |
| InChIKey | NOFFTAFBRKKGQI-PHZXCRFESA-N |
| XLogP | 5.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |