C16H15N3O2 — CID 144689521
1-(2,3-dihydro-1H-indol-3-yl)-4-pyrimidin-5-ylbutane-1,4-dione (PubChem CID 144689521) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-3-yl)-4-pyrimidin-5-ylbutane-1,4-dione.
| Compound Name | 1-(2,3-dihydro-1H-indol-3-yl)-4-pyrimidin-5-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 144689521 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-3-yl)-4-pyrimidin-5-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)C1CNc2ccccc21)c1cncnc1 |
| InChI | InChI=1S/C16H15N3O2/c20-15(11-7-17-10-18-8-11)5-6-16(21)13-9-19-14-4-2-1-3-12(13)14/h1-4,7-8,10,13,19H,5-6,9H2 |
| InChIKey | ATXGOYRPWJHXTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |