About ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene
ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene (PubChem CID 144689703) has the molecular formula C12H26S
and a molecular weight of 202.41 g/mol. Its IUPAC name is ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene.
Analyze ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene?
The IUPAC name of ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene (CID 144689703) is ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene.
What is the SMILES notation for ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene?
The canonical SMILES for ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene is CC.CC.CC1=C(C)C(C)C(C)S1.
What is the InChIKey of ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene?
The InChIKey is UERINCFBBDNVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S.2C2H6/c1-5-6(2)8(4)9-7(5)3;2*1-2/h5,7H,1-4H3;2*1-2H3.
What are the key properties of ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene?
ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene has a molecular weight of 202.41 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,3,4,5-tetramethyl-2,3-dihydrothiophene is sourced from PubChem (CID 144689703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).