C10H11FO+2 — CID 144690795
1-ethoxy-4-(1-fluoroethenyl)cyclohexa-1,4-diene (PubChem CID 144690795) has the molecular formula C10H11FO+2 and a molecular weight of 166.19 g/mol. Its IUPAC name is 1-ethoxy-4-(1-fluoroethenyl)cyclohexa-1,4-diene.
| Compound Name | 1-ethoxy-4-(1-fluoroethenyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 144690795 |
| Molecular Formula | C10H11FO+2 |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-ethoxy-4-(1-fluoroethenyl)cyclohexa-1,4-diene |
| SMILES | C=C(F)C1=C[CH+]C(OCC)=C[CH+]1 |
| InChI | InChI=1S/C10H11FO/c1-3-12-10-6-4-9(5-7-10)8(2)11/h4-7H,2-3H2,1H3/q+2 |
| InChIKey | VSYBNHNFUMQGLF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|