C18H22N5O+ — CID 144697186
[(2-amino-5-prop-1-en-2-yloxyphenyl)-(6-pyrrolidin-1-ylpyrimidin-4-yl)methylidene]azanium (PubChem CID 144697186) has the molecular formula C18H22N5O+ and a molecular weight of 324.41 g/mol. Its IUPAC name is [(2-amino-5-prop-1-en-2-yloxyphenyl)-(6-pyrrolidin-1-ylpyrimidin-4-yl)methylidene]azanium.
| Compound Name | [(2-amino-5-prop-1-en-2-yloxyphenyl)-(6-pyrrolidin-1-ylpyrimidin-4-yl)methylidene]azanium |
|---|---|
| PubChem CID | 144697186 |
| Molecular Formula | C18H22N5O+ |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(2-amino-5-prop-1-en-2-yloxyphenyl)-(6-pyrrolidin-1-ylpyrimidin-4-yl)methylidene]azanium |
| SMILES | C=C(C)Oc1ccc(N)c(C(=[NH2+])c2cc(N3CCCC3)ncn2)c1 |
| InChI | InChI=1S/C18H21N5O/c1-12(2)24-13-5-6-15(19)14(9-13)18(20)16-10-17(22-11-21-16)23-7-3-4-8-23/h5-6,9-11,20H,1,3-4,7-8,19H2,2H3/p+1 |
| InChIKey | HSUNWBVDVQQYNW-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|