C21H30N6O2 — CID 123983506
2-[N-ethyl-C-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]carbonimidoyl]-4-(2-methoxyethoxy)aniline (PubChem CID 123983506) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[N-ethyl-C-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]carbonimidoyl]-4-(2-methoxyethoxy)aniline.
| Compound Name | 2-[N-ethyl-C-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]carbonimidoyl]-4-(2-methoxyethoxy)aniline |
|---|---|
| PubChem CID | 123983506 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[N-ethyl-C-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]carbonimidoyl]-4-(2-methoxyethoxy)aniline |
| SMILES | CC/N=C(\c1cc(N2CCN(C)CC2)ncn1)c1cc(OCCOC)ccc1N |
| InChI | InChI=1S/C21H30N6O2/c1-4-23-21(17-13-16(5-6-18(17)22)29-12-11-28-3)19-14-20(25-15-24-19)27-9-7-26(2)8-10-27/h5-6,13-15H,4,7-12,22H2,1-3H3/b23-21- |
| InChIKey | ZAKCIKOAHQOVGF-LNVKXUELSA-N |
| XLogP | 1.69 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|