C21H27N6O2+ — CID 144697434
[[2-amino-5-(1-ethylcyclopropyl)oxyphenyl]-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]methylidene]azanium (PubChem CID 144697434) has the molecular formula C21H27N6O2+ and a molecular weight of 395.49 g/mol. Its IUPAC name is [[2-amino-5-(1-ethylcyclopropyl)oxyphenyl]-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]methylidene]azanium.
| Compound Name | [[2-amino-5-(1-ethylcyclopropyl)oxyphenyl]-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]methylidene]azanium |
|---|---|
| PubChem CID | 144697434 |
| Molecular Formula | C21H27N6O2+ |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [[2-amino-5-(1-ethylcyclopropyl)oxyphenyl]-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]methylidene]azanium |
| SMILES | CCC1(Oc2ccc(N)c(C(=[NH2+])c3cc(N4CCN(C)C(=O)C4)ncn3)c2)CC1 |
| InChI | InChI=1S/C21H26N6O2/c1-3-21(6-7-21)29-14-4-5-16(22)15(10-14)20(23)17-11-18(25-13-24-17)27-9-8-26(2)19(28)12-27/h4-5,10-11,13,23H,3,6-9,12,22H2,1-2H3/p+1 |
| InChIKey | BDWOSKKYZWIQCZ-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|