C21H26N6O — CID 130414664
(3S)-1-[6-[2-amino-5-(1-ethylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-3,6-dihydro-2H-pyridin-3-amine (PubChem CID 130414664) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is (3S)-1-[6-[2-amino-5-(1-ethylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-3,6-dihydro-2H-pyridin-3-amine.
| Compound Name | (3S)-1-[6-[2-amino-5-(1-ethylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-3,6-dihydro-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 130414664 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (3S)-1-[6-[2-amino-5-(1-ethylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-3,6-dihydro-2H-pyridin-3-amine |
| SMILES | [H]/N=C(\c1cc(N2CC=C[C@H](N)C2)ncn1)c1cc(OC2(CC)CC2)ccc1N |
| InChI | InChI=1S/C21H26N6O/c1-2-21(7-8-21)28-15-5-6-17(23)16(10-15)20(24)18-11-19(26-13-25-18)27-9-3-4-14(22)12-27/h3-6,10-11,13-14,24H,2,7-9,12,22-23H2,1H3/b24-20-/t14-/m0/s1 |
| InChIKey | USPJMGVRBQYDTO-PNRGMXNKSA-N |
| XLogP | 2.50 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|