C21H25N5O2 — CID 130414570
4-(1-ethylcyclopropyl)oxy-2-[6-[(2R)-2-methyl-2,3-dihydro-1,4-oxazin-4-yl]pyrimidine-4-carboximidoyl]aniline (PubChem CID 130414570) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-(1-ethylcyclopropyl)oxy-2-[6-[(2R)-2-methyl-2,3-dihydro-1,4-oxazin-4-yl]pyrimidine-4-carboximidoyl]aniline.
| Compound Name | 4-(1-ethylcyclopropyl)oxy-2-[6-[(2R)-2-methyl-2,3-dihydro-1,4-oxazin-4-yl]pyrimidine-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 130414570 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-(1-ethylcyclopropyl)oxy-2-[6-[(2R)-2-methyl-2,3-dihydro-1,4-oxazin-4-yl]pyrimidine-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1cc(N2C=CO[C@H](C)C2)ncn1)c1cc(OC2(CC)CC2)ccc1N |
| InChI | InChI=1S/C21H25N5O2/c1-3-21(6-7-21)28-15-4-5-17(22)16(10-15)20(23)18-11-19(25-13-24-18)26-8-9-27-14(2)12-26/h4-5,8-11,13-14,23H,3,6-7,12,22H2,1-2H3/b23-20-/t14-/m1/s1 |
| InChIKey | WBWWWYIVESJGED-LFAMDWDUSA-N |
| XLogP | 3.49 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|