C24H24N7O2+ — CID 144697825
[(2-amino-5-propan-2-yloxyphenyl)-[2-[[2-(1,2,4-triazol-1-yl)benzoyl]amino]-4-pyridinyl]methylidene]azanium (PubChem CID 144697825) has the molecular formula C24H24N7O2+ and a molecular weight of 442.50 g/mol. Its IUPAC name is [(2-amino-5-propan-2-yloxyphenyl)-[2-[[2-(1,2,4-triazol-1-yl)benzoyl]amino]-4-pyridinyl]methylidene]azanium.
| Compound Name | [(2-amino-5-propan-2-yloxyphenyl)-[2-[[2-(1,2,4-triazol-1-yl)benzoyl]amino]-4-pyridinyl]methylidene]azanium |
|---|---|
| PubChem CID | 144697825 |
| Molecular Formula | C24H24N7O2+ |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [(2-amino-5-propan-2-yloxyphenyl)-[2-[[2-(1,2,4-triazol-1-yl)benzoyl]amino]-4-pyridinyl]methylidene]azanium |
| SMILES | CC(C)Oc1ccc(N)c(C(=[NH2+])c2ccnc(NC(=O)c3ccccc3-n3cncn3)c2)c1 |
| InChI | InChI=1S/C24H23N7O2/c1-15(2)33-17-7-8-20(25)19(12-17)23(26)16-9-10-28-22(11-16)30-24(32)18-5-3-4-6-21(18)31-14-27-13-29-31/h3-15,26H,25H2,1-2H3,(H,28,30,32)/p+1 |
| InChIKey | FGSGFOKPWCVRMJ-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|