C26H48O2 — CID 144704905
(2,4-ditert-butylcyclohexyl) 2-but-2-en-2-yl-2,4-dimethylhexanoate (PubChem CID 144704905) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is (2,4-ditert-butylcyclohexyl) 2-but-2-en-2-yl-2,4-dimethylhexanoate.
| Compound Name | (2,4-ditert-butylcyclohexyl) 2-but-2-en-2-yl-2,4-dimethylhexanoate |
|---|---|
| PubChem CID | 144704905 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | (2,4-ditert-butylcyclohexyl) 2-but-2-en-2-yl-2,4-dimethylhexanoate |
| SMILES | CC=C(C)C(C)(CC(C)CC)C(=O)OC1CCC(C(C)(C)C)CC1C(C)(C)C |
| InChI | InChI=1S/C26H48O2/c1-12-18(3)17-26(11,19(4)13-2)23(27)28-22-15-14-20(24(5,6)7)16-21(22)25(8,9)10/h13,18,20-22H,12,14-17H2,1-11H3 |
| InChIKey | PDPVJEOQBNRJHQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|