C22H21ClF3N5O4+2 — CID 144707109
[4-[[1-(2-aminoethyl)-3-methyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-7-yl]methyl]phenyl]chloranium (PubChem CID 144707109) has the molecular formula C22H21ClF3N5O4+2 and a molecular weight of 511.89 g/mol. Its IUPAC name is [4-[[1-(2-aminoethyl)-3-methyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-7-yl]methyl]phenyl]chloranium.
| Compound Name | [4-[[1-(2-aminoethyl)-3-methyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-7-yl]methyl]phenyl]chloranium |
|---|---|
| PubChem CID | 144707109 |
| Molecular Formula | C22H21ClF3N5O4+2 |
| Molecular Weight | 511.89 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | [4-[[1-(2-aminoethyl)-3-methyl-2,6-dioxo-8-[3-(trifluoromethoxy)phenoxy]-9H-purin-7-ium-7-yl]methyl]phenyl]chloranium |
| SMILES | Cn1c(=O)n(CCN)c(=O)c2c1[nH]c(Oc1cccc(OC(F)(F)F)c1)[n+]2Cc1ccc([ClH+])cc1 |
| InChI | InChI=1S/C22H20ClF3N5O4/c1-29-18-17(19(32)30(10-9-27)21(29)33)31(12-13-5-7-14(23)8-6-13)20(28-18)34-15-3-2-4-16(11-15)35-22(24,25)26/h2-8,11,23H,9-10,12,27H2,1H3/q+1/p+1 |
| InChIKey | XVAJAPDALZLMBJ-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|