C22H30FN3 — CID 144707264
(E)-N-(3,5-dimethyl-2,6-dimethylidene-1-pentylpyrimidin-4-yl)-1-(2-fluorophenyl)propan-2-imine (PubChem CID 144707264) has the molecular formula C22H30FN3 and a molecular weight of 355.50 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-2,6-dimethylidene-1-pentylpyrimidin-4-yl)-1-(2-fluorophenyl)propan-2-imine.
| Compound Name | (E)-N-(3,5-dimethyl-2,6-dimethylidene-1-pentylpyrimidin-4-yl)-1-(2-fluorophenyl)propan-2-imine |
|---|---|
| PubChem CID | 144707264 |
| Molecular Formula | C22H30FN3 |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (E)-N-(3,5-dimethyl-2,6-dimethylidene-1-pentylpyrimidin-4-yl)-1-(2-fluorophenyl)propan-2-imine |
| SMILES | C=C1C(C)=C(/N=C(\C)Cc2ccccc2F)N(C)C(=C)N1CCCCC |
| InChI | InChI=1S/C22H30FN3/c1-7-8-11-14-26-18(4)17(3)22(25(6)19(26)5)24-16(2)15-20-12-9-10-13-21(20)23/h9-10,12-13H,4-5,7-8,11,14-15H2,1-3,6H3/b24-16+ |
| InChIKey | NEABCIIHJZDUTC-LFVJCYFKSA-N |
| XLogP | 5.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|