C23H37NO3 — CID 144708763
methyl 7-[2-[(E)-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 144708763) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is methyl 7-[2-[(E)-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[2-[(E)-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 144708763 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | methyl 7-[2-[(E)-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCCC#CCC(C)C/C=C/C1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H37NO3/c1-4-5-6-9-13-20(2)14-12-15-21-17-18-22(25)24(21)19-11-8-7-10-16-23(26)27-3/h12,15,20-21H,4-5,7-8,10-11,13-14,16-19H2,1-3H3/b15-12+ |
| InChIKey | DYUIAMIRFKWFSQ-NTCAYCPXSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|