C22H35NO3 — CID 144708788
methyl 7-[2-[(E)-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 144708788) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is methyl 7-[2-[(E)-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[2-[(E)-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 144708788 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | methyl 7-[2-[(E)-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CCC(C)C/C=C/C1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H35NO3/c1-4-5-8-12-19(2)13-11-14-20-16-17-21(24)23(20)18-10-7-6-9-15-22(25)26-3/h11,14,19-20H,4,6-7,9-10,12-13,15-18H2,1-3H3/b14-11+ |
| InChIKey | RBDWFVCQVIZVAY-SDNWHVSQSA-N |
| XLogP | 4.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|