C11H17N — CID 144709552
2-azatricyclo[6.3.1.02,6]dodec-1(11)-ene (PubChem CID 144709552) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-azatricyclo[6.3.1.02,6]dodec-1(11)-ene.
| Compound Name | 2-azatricyclo[6.3.1.02,6]dodec-1(11)-ene |
|---|---|
| PubChem CID | 144709552 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-azatricyclo[6.3.1.02,6]dodec-1(11)-ene |
| SMILES | C1=C2CC(CC1)CC1CCCN21 |
| InChI | InChI=1S/C11H17N/c1-3-9-7-10(4-1)12-6-2-5-11(12)8-9/h4,9,11H,1-3,5-8H2 |
| InChIKey | GUTXWLDCOMXRMB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |