C10H22N4 — CID 144709725
N'-[(E)-2-[2-(dimethylamino)ethyl-methylamino]prop-1-enyl]ethanimidamide (PubChem CID 144709725) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is N'-[(E)-2-[2-(dimethylamino)ethyl-methylamino]prop-1-enyl]ethanimidamide.
| Compound Name | N'-[(E)-2-[2-(dimethylamino)ethyl-methylamino]prop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 144709725 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | N'-[(E)-2-[2-(dimethylamino)ethyl-methylamino]prop-1-enyl]ethanimidamide |
| SMILES | C/C(=C\N=C(/C)N)N(C)CCN(C)C |
| InChI | InChI=1S/C10H22N4/c1-9(8-12-10(2)11)14(5)7-6-13(3)4/h8H,6-7H2,1-5H3,(H2,11,12)/b9-8+ |
| InChIKey | QVMCGXJRQLJBKW-CMDGGOBGSA-N |
| XLogP | 0.72 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|