C6H11N3 — CID 149421949
2,3-dimethyl-4H-pyrimidin-5-amine (PubChem CID 149421949) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 2,3-dimethyl-4H-pyrimidin-5-amine.
| Compound Name | 2,3-dimethyl-4H-pyrimidin-5-amine |
|---|---|
| PubChem CID | 149421949 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2,3-dimethyl-4H-pyrimidin-5-amine |
| SMILES | CC1=NC=C(N)CN1C |
| InChI | InChI=1S/C6H11N3/c1-5-8-3-6(7)4-9(5)2/h3H,4,7H2,1-2H3 |
| InChIKey | YTINKIVFMUXMRD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |