C25H33NO2 — CID 144710114
[4-[(Z)-1-[[(2Z)-2-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-4-methylpenta-2,4-dienylidene]amino]-3-methylbut-1-enyl]phenyl]methanol (PubChem CID 144710114) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is [4-[(Z)-1-[[(2Z)-2-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-4-methylpenta-2,4-dienylidene]amino]-3-methylbut-1-enyl]phenyl]methanol.
| Compound Name | [4-[(Z)-1-[[(2Z)-2-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-4-methylpenta-2,4-dienylidene]amino]-3-methylbut-1-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 144710114 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | [4-[(Z)-1-[[(2Z)-2-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-4-methylpenta-2,4-dienylidene]amino]-3-methylbut-1-enyl]phenyl]methanol |
| SMILES | C=C(C)/C=C(\C=N\C(=C/C(C)C)c1ccc(CO)cc1)C(/C(=C)C)=C(\C)OC |
| InChI | InChI=1S/C25H33NO2/c1-17(2)13-23(25(19(5)6)20(7)28-8)15-26-24(14-18(3)4)22-11-9-21(16-27)10-12-22/h9-15,18,27H,1,5,16H2,2-4,6-8H3/b23-13+,24-14-,25-20+,26-15+ |
| InChIKey | ZSLPTIBFUKHPJH-GXDFXJQHSA-N |
| XLogP | 6.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|