C25H36N4O3S — CID 144711535
ethane;formamide;4-[[4-(4-morpholin-4-ylsulfanylphenyl)phenyl]methyl]piperazine-1-carbaldehyde (PubChem CID 144711535) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is ethane;formamide;4-[[4-(4-morpholin-4-ylsulfanylphenyl)phenyl]methyl]piperazine-1-carbaldehyde.
| Compound Name | ethane;formamide;4-[[4-(4-morpholin-4-ylsulfanylphenyl)phenyl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 144711535 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | ethane;formamide;4-[[4-(4-morpholin-4-ylsulfanylphenyl)phenyl]methyl]piperazine-1-carbaldehyde |
| SMILES | CC.NC=O.O=CN1CCN(Cc2ccc(-c3ccc(SN4CCOCC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O2S.C2H6.CH3NO/c26-18-24-11-9-23(10-12-24)17-19-1-3-20(4-2-19)21-5-7-22(8-6-21)28-25-13-15-27-16-14-25;1-2;2-1-3/h1-8,18H,9-17H2;1-2H3;1H,(H2,2,3) |
| InChIKey | WYKGKKYWRDGSNP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|