C31H41N3O2S — CID 144711647
ethane;formamide;4-[4-[4-[(3-phenylpiperidin-1-yl)methyl]phenyl]phenyl]sulfanylmorpholine (PubChem CID 144711647) has the molecular formula C31H41N3O2S and a molecular weight of 519.76 g/mol. Its IUPAC name is ethane;formamide;4-[4-[4-[(3-phenylpiperidin-1-yl)methyl]phenyl]phenyl]sulfanylmorpholine.
| Compound Name | ethane;formamide;4-[4-[4-[(3-phenylpiperidin-1-yl)methyl]phenyl]phenyl]sulfanylmorpholine |
|---|---|
| PubChem CID | 144711647 |
| Molecular Formula | C31H41N3O2S |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | ethane;formamide;4-[4-[4-[(3-phenylpiperidin-1-yl)methyl]phenyl]phenyl]sulfanylmorpholine |
| SMILES | CC.NC=O.c1ccc(C2CCCN(Cc3ccc(-c4ccc(SN5CCOCC5)cc4)cc3)C2)cc1 |
| InChI | InChI=1S/C28H32N2OS.C2H6.CH3NO/c1-2-5-24(6-3-1)27-7-4-16-29(22-27)21-23-8-10-25(11-9-23)26-12-14-28(15-13-26)32-30-17-19-31-20-18-30;1-2;2-1-3/h1-3,5-6,8-15,27H,4,7,16-22H2;1-2H3;1H,(H2,2,3) |
| InChIKey | QLESQURIJMKLMR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|