C28H33N3O2S — CID 144711747
formamide;4-[4-[4-[(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]sulfanylmorpholine (PubChem CID 144711747) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is formamide;4-[4-[4-[(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]sulfanylmorpholine.
| Compound Name | formamide;4-[4-[4-[(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]sulfanylmorpholine |
|---|---|
| PubChem CID | 144711747 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | formamide;4-[4-[4-[(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]sulfanylmorpholine |
| SMILES | CC1Cc2ccccc2CN1Cc1ccc(-c2ccc(SN3CCOCC3)cc2)cc1.NC=O |
| InChI | InChI=1S/C27H30N2OS.CH3NO/c1-21-18-25-4-2-3-5-26(25)20-28(21)19-22-6-8-23(9-7-22)24-10-12-27(13-11-24)31-29-14-16-30-17-15-29;2-1-3/h2-13,21H,14-20H2,1H3;1H,(H2,2,3) |
| InChIKey | NUCZUQWGTVTGBO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|