C29H39N3O2S — CID 144711499
N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanyl-2-methoxy-N-methylethanamine;ethane;formamide (PubChem CID 144711499) has the molecular formula C29H39N3O2S and a molecular weight of 493.72 g/mol. Its IUPAC name is N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanyl-2-methoxy-N-methylethanamine;ethane;formamide.
| Compound Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanyl-2-methoxy-N-methylethanamine;ethane;formamide |
|---|---|
| PubChem CID | 144711499 |
| Molecular Formula | C29H39N3O2S |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | N-[4-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]phenyl]sulfanyl-2-methoxy-N-methylethanamine;ethane;formamide |
| SMILES | CC.COCCN(C)Sc1ccc(-c2ccc(CN3CCc4ccccc4C3)cc2)cc1.NC=O |
| InChI | InChI=1S/C26H30N2OS.C2H6.CH3NO/c1-27(17-18-29-2)30-26-13-11-24(12-14-26)23-9-7-21(8-10-23)19-28-16-15-22-5-3-4-6-25(22)20-28;1-2;2-1-3/h3-14H,15-20H2,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | UUVRCIQXYIJTMQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|