C25H36N4O3S — CID 59826019
N-benzyl-N-(3-morpholin-4-ylpropyl)-4-(piperazin-1-ylmethyl)benzenesulfonamide (PubChem CID 59826019) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is N-benzyl-N-(3-morpholin-4-ylpropyl)-4-(piperazin-1-ylmethyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-(3-morpholin-4-ylpropyl)-4-(piperazin-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59826019 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-benzyl-N-(3-morpholin-4-ylpropyl)-4-(piperazin-1-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(CN2CCNCC2)cc1)N(CCCN1CCOCC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N4O3S/c30-33(31,25-9-7-24(8-10-25)21-28-15-11-26-12-16-28)29(22-23-5-2-1-3-6-23)14-4-13-27-17-19-32-20-18-27/h1-3,5-10,26H,4,11-22H2 |
| InChIKey | KEIWLUKTYJDBAS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |