C26H29ClN2O4S — CID 42698256
4-chloro-N-(2-morpholin-4-ylethyl)-N-[(4-phenylmethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 42698256) has the molecular formula C26H29ClN2O4S and a molecular weight of 501.05 g/mol. Its IUPAC name is 4-chloro-N-(2-morpholin-4-ylethyl)-N-[(4-phenylmethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-morpholin-4-ylethyl)-N-[(4-phenylmethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42698256 |
| Molecular Formula | C26H29ClN2O4S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 4-chloro-N-(2-morpholin-4-ylethyl)-N-[(4-phenylmethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(CCN1CCOCC1)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29ClN2O4S/c27-24-8-12-26(13-9-24)34(30,31)29(15-14-28-16-18-32-19-17-28)20-22-6-10-25(11-7-22)33-21-23-4-2-1-3-5-23/h1-13H,14-21H2 |
| InChIKey | GIBWWHOZFMALDE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |