C31H32FN3O2S — CID 46886359
N-benzyl-4-fluoro-N-[[4-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 46886359) has the molecular formula C31H32FN3O2S and a molecular weight of 529.68 g/mol. Its IUPAC name is N-benzyl-4-fluoro-N-[[4-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-fluoro-N-[[4-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46886359 |
| Molecular Formula | C31H32FN3O2S |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-benzyl-4-fluoro-N-[[4-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)cc1)N(Cc1ccccc1)Cc1ccc(-c2cccc(CN3CCNCC3)c2)cc1 |
| InChI | InChI=1S/C31H32FN3O2S/c32-30-13-15-31(16-14-30)38(36,37)35(23-25-5-2-1-3-6-25)24-26-9-11-28(12-10-26)29-8-4-7-27(21-29)22-34-19-17-33-18-20-34/h1-16,21,33H,17-20,22-24H2 |
| InChIKey | LZBKXBZDNHTOOM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |