C28H37N3OS — CID 144711617
ethane;N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide (PubChem CID 144711617) has the molecular formula C28H37N3OS and a molecular weight of 463.69 g/mol. Its IUPAC name is ethane;N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide.
| Compound Name | ethane;N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 144711617 |
| Molecular Formula | C28H37N3OS |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | ethane;N-[4-[ethyl(methyl)amino]sulfanylphenyl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)benzamide |
| SMILES | CC.CCN(C)Sc1ccc(NC(=O)c2ccc(CN3CCC4=C(C=CCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C26H31N3OS.C2H6/c1-3-28(2)31-25-14-12-24(13-15-25)27-26(30)22-10-8-20(9-11-22)18-29-17-16-21-6-4-5-7-23(21)19-29;1-2/h5,7-15H,3-4,6,16-19H2,1-2H3,(H,27,30);1-2H3 |
| InChIKey | ZGQAJVNKVAQUQN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|