About 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline
2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline (PubChem CID 144718475) has the molecular formula C17H20N2S
and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline.
Molecular Properties
| Compound Name | 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline |
| PubChem CID | 144718475 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline |
| SMILES | C=C(Nc1ccccc1)c1ccccc1NS(=C)CC |
| InChI | InChI=1S/C17H20N2S/c1-4-20(3)19-17-13-9-8-12-16(17)14(2)18-15-10-6-5-7-11-15/h5-13,18-19H,2-4H2,1H3 |
| InChIKey | BOILFCOQXVGEIR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline?
The IUPAC name of 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline (CID 144718475) is 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline.
What is the SMILES notation for 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline?
The canonical SMILES for 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline is C=C(Nc1ccccc1)c1ccccc1NS(=C)CC.
What is the InChIKey of 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline?
The InChIKey is BOILFCOQXVGEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2S/c1-4-20(3)19-17-13-9-8-12-16(17)14(2)18-15-10-6-5-7-11-15/h5-13,18-19H,2-4H2,1H3.
What are the key properties of 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline?
2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline has a molecular weight of 284.43 g/mol, XLogP of 4.82, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-anilinoethenyl)-N-[ethyl(methylidene)-λ4-sulfanyl]aniline is sourced from PubChem (CID 144718475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).