C12H8F5NO2S — CID 144720065
(2,3,4,5,6-pentafluorophenyl) 4-cyano-4-sulfanylpentanoate (PubChem CID 144720065) has the molecular formula C12H8F5NO2S and a molecular weight of 325.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-cyano-4-sulfanylpentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-cyano-4-sulfanylpentanoate |
|---|---|
| PubChem CID | 144720065 |
| Molecular Formula | C12H8F5NO2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-cyano-4-sulfanylpentanoate |
| SMILES | CC(S)(C#N)CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8F5NO2S/c1-12(21,4-18)3-2-5(19)20-11-9(16)7(14)6(13)8(15)10(11)17/h21H,2-3H2,1H3 |
| InChIKey | RRGOJPWNAWGFDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|