C16H29NO2 — CID 144721101
1-(3,3-dimethyl-2-methylideneheptyl)pyrrolidine-2,5-dione;ethane (PubChem CID 144721101) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-methylideneheptyl)pyrrolidine-2,5-dione;ethane.
| Compound Name | 1-(3,3-dimethyl-2-methylideneheptyl)pyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 144721101 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 1-(3,3-dimethyl-2-methylideneheptyl)pyrrolidine-2,5-dione;ethane |
| SMILES | C=C(CN1C(=O)CCC1=O)C(C)(C)CCCC.CC |
| InChI | InChI=1S/C14H23NO2.C2H6/c1-5-6-9-14(3,4)11(2)10-15-12(16)7-8-13(15)17;1-2/h2,5-10H2,1,3-4H3;1-2H3 |
| InChIKey | HUASIPHQTMHGGU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|