C24H37FN2O — CID 144721250
3-cyclohexyl-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(2-propylpentyl)urea (PubChem CID 144721250) has the molecular formula C24H37FN2O and a molecular weight of 388.57 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(2-propylpentyl)urea.
| Compound Name | 3-cyclohexyl-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(2-propylpentyl)urea |
|---|---|
| PubChem CID | 144721250 |
| Molecular Formula | C24H37FN2O |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 3-cyclohexyl-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(2-propylpentyl)urea |
| SMILES | CCCC(CCC)CN(C/C=C/c1ccc(F)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H37FN2O/c1-3-9-21(10-4-2)19-27(24(28)26-23-12-6-5-7-13-23)18-8-11-20-14-16-22(25)17-15-20/h8,11,14-17,21,23H,3-7,9-10,12-13,18-19H2,1-2H3,(H,26,28)/b11-8+ |
| InChIKey | GYIATQQWVDNPLW-DHZHZOJOSA-N |
| XLogP | 6.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |