C15H13BrF3N3O2 — CID 144721579
5-bromo-1-methanimidoyl-4-[[3-methyl-5-(trifluoromethoxy)phenoxy]methyl]pyridin-2-imine (PubChem CID 144721579) has the molecular formula C15H13BrF3N3O2 and a molecular weight of 404.19 g/mol. Its IUPAC name is 5-bromo-1-methanimidoyl-4-[[3-methyl-5-(trifluoromethoxy)phenoxy]methyl]pyridin-2-imine.
| Compound Name | 5-bromo-1-methanimidoyl-4-[[3-methyl-5-(trifluoromethoxy)phenoxy]methyl]pyridin-2-imine |
|---|---|
| PubChem CID | 144721579 |
| Molecular Formula | C15H13BrF3N3O2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 5-bromo-1-methanimidoyl-4-[[3-methyl-5-(trifluoromethoxy)phenoxy]methyl]pyridin-2-imine |
| SMILES | [H]/N=C/n1cc(Br)c(COc2cc(C)cc(OC(F)(F)F)c2)c/c1=N\[H] |
| InChI | InChI=1S/C15H13BrF3N3O2/c1-9-2-11(5-12(3-9)24-15(17,18)19)23-7-10-4-14(21)22(8-20)6-13(10)16/h2-6,8,20-21H,7H2,1H3/b20-8+,21-14+ |
| InChIKey | CFANXNRDRLGSAR-IZTPJPFJSA-N |
| XLogP | 3.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|