C44H50BF6O2P — CID 175358013
[3,5-bis(trifluoromethoxy)phenyl]phosphanium;tetrakis(2,4,6-trimethylphenyl)boranuide (PubChem CID 175358013) has the molecular formula C44H50BF6O2P and a molecular weight of 766.66 g/mol. Its IUPAC name is [3,5-bis(trifluoromethoxy)phenyl]phosphanium;tetrakis(2,4,6-trimethylphenyl)boranuide.
| Compound Name | [3,5-bis(trifluoromethoxy)phenyl]phosphanium;tetrakis(2,4,6-trimethylphenyl)boranuide |
|---|---|
| PubChem CID | 175358013 |
| Molecular Formula | C44H50BF6O2P |
| Molecular Weight | 766.66 g/mol |
| Exact Mass | 766.35 |
| IUPAC Name | [3,5-bis(trifluoromethoxy)phenyl]phosphanium;tetrakis(2,4,6-trimethylphenyl)boranuide |
| SMILES | Cc1cc(C)c([B-](c2c(C)cc(C)cc2C)(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1.FC(F)(F)Oc1cc([PH3+])cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C36H44B.C8H5F6O2P/c1-21-13-25(5)33(26(6)14-21)37(34-27(7)15-22(2)16-28(34)8,35-29(9)17-23(3)18-30(35)10)36-31(11)19-24(4)20-32(36)12;9-7(10,11)15-4-1-5(3-6(17)2-4)16-8(12,13)14/h13-20H,1-12H3;1-3H,17H2/q-1;/p+1 |
| InChIKey | XIRXCWQCXCPWHT-UHFFFAOYSA-O |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.66 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|