C9H14F3N3 — CID 144724033
(Z)-1-(1,2-dihydropyridin-2-yl)prop-1-en-1-amine;trifluoromethanamine (PubChem CID 144724033) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is (Z)-1-(1,2-dihydropyridin-2-yl)prop-1-en-1-amine;trifluoromethanamine.
| Compound Name | (Z)-1-(1,2-dihydropyridin-2-yl)prop-1-en-1-amine;trifluoromethanamine |
|---|---|
| PubChem CID | 144724033 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (Z)-1-(1,2-dihydropyridin-2-yl)prop-1-en-1-amine;trifluoromethanamine |
| SMILES | C/C=C(\N)C1C=CC=CN1.NC(F)(F)F |
| InChI | InChI=1S/C8H12N2.CH2F3N/c1-2-7(9)8-5-3-4-6-10-8;2-1(3,4)5/h2-6,8,10H,9H2,1H3;5H2/b7-2-; |
| InChIKey | LVWFETLEWYICTN-YMWUIOJXSA-N |
| XLogP | 1.36 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|