C11H15N2+ — CID 144727127
1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyrazin-1-ium (PubChem CID 144727127) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyrazin-1-ium.
| Compound Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyrazin-1-ium |
|---|---|
| PubChem CID | 144727127 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyrazin-1-ium |
| SMILES | C=C(C)/C=C\C(=C)[N+]1=CC=NCC1 |
| InChI | InChI=1S/C11H15N2/c1-10(2)4-5-11(3)13-8-6-12-7-9-13/h4-6,8H,1,3,7,9H2,2H3/q+1/b5-4- |
| InChIKey | XTAWXINEUGGQCS-PLNGDYQASA-N |
| XLogP | 1.80 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|