C11H12N2 — CID 89009892
6,6-dimethylcyclohepta[b]pyrazine (PubChem CID 89009892) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 6,6-dimethylcyclohepta[b]pyrazine.
| Compound Name | 6,6-dimethylcyclohepta[b]pyrazine |
|---|---|
| PubChem CID | 89009892 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 6,6-dimethylcyclohepta[b]pyrazine |
| SMILES | CC1(C)C=CC=c2nccnc2=C1 |
| InChI | InChI=1S/C11H12N2/c1-11(2)5-3-4-9-10(8-11)13-7-6-12-9/h3-8H,1-2H3 |
| InChIKey | UQVFJYDZKSBEBY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |