C9H12N2 — CID 54183530
1-methyl-4,6-dihydro-1H-pyrido[1,2-a]pyrazine (PubChem CID 54183530) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-4,6-dihydro-1H-pyrido[1,2-a]pyrazine.
| Compound Name | 1-methyl-4,6-dihydro-1H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 54183530 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-4,6-dihydro-1H-pyrido[1,2-a]pyrazine |
| SMILES | CC1N=CCN2CC=CC=C12 |
| InChI | InChI=1S/C9H12N2/c1-8-9-4-2-3-6-11(9)7-5-10-8/h2-5,8H,6-7H2,1H3 |
| InChIKey | PDNKNBOLRRJARI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |