C8H10N2 — CID 54042125
4,6-dihydro-1H-pyrido[1,2-a]pyrazine (PubChem CID 54042125) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 4,6-dihydro-1H-pyrido[1,2-a]pyrazine.
| Compound Name | 4,6-dihydro-1H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 54042125 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4,6-dihydro-1H-pyrido[1,2-a]pyrazine |
| SMILES | C1=CCN2CC=NCC2=C1 |
| InChI | InChI=1S/C8H10N2/c1-2-5-10-6-4-9-7-8(10)3-1/h1-4H,5-7H2 |
| InChIKey | LNCBDTLWRSABJX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |