C36H64O3 — CID 144728153
2,2,3-trimethylbutane;[2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] formate (PubChem CID 144728153) has the molecular formula C36H64O3 and a molecular weight of 544.91 g/mol. Its IUPAC name is 2,2,3-trimethylbutane;[2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] formate.
| Compound Name | 2,2,3-trimethylbutane;[2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] formate |
|---|---|
| PubChem CID | 144728153 |
| Molecular Formula | C36H64O3 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.49 |
| IUPAC Name | 2,2,3-trimethylbutane;[2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] formate |
| SMILES | CC(C)C(C)(C)C.Cc1cc2c(c(C)c1OC=O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H48O3.C7H16/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-17-29(7)18-16-26-25(6)28(31-20-30)24(5)19-27(26)32-29;1-6(2)7(3,4)5/h19-23H,8-18H2,1-7H3;6H,1-5H3 |
| InChIKey | YVMAMCVKFCGFDJ-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|