C31H29ClF2N2O6 — CID 144729150
ethane;[2-(4-fluorophenyl)-2-oxoethyl] 2-[4-(5-chloro-2-nitrophenyl)-2-oxo-1-pyridinyl]-3-(4-fluorophenyl)propanoate;methane (PubChem CID 144729150) has the molecular formula C31H29ClF2N2O6 and a molecular weight of 599.03 g/mol. Its IUPAC name is ethane;[2-(4-fluorophenyl)-2-oxoethyl] 2-[4-(5-chloro-2-nitrophenyl)-2-oxo-1-pyridinyl]-3-(4-fluorophenyl)propanoate;methane.
| Compound Name | ethane;[2-(4-fluorophenyl)-2-oxoethyl] 2-[4-(5-chloro-2-nitrophenyl)-2-oxo-1-pyridinyl]-3-(4-fluorophenyl)propanoate;methane |
|---|---|
| PubChem CID | 144729150 |
| Molecular Formula | C31H29ClF2N2O6 |
| Molecular Weight | 599.03 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | ethane;[2-(4-fluorophenyl)-2-oxoethyl] 2-[4-(5-chloro-2-nitrophenyl)-2-oxo-1-pyridinyl]-3-(4-fluorophenyl)propanoate;methane |
| SMILES | C.CC.O=C(COC(=O)C(Cc1ccc(F)cc1)n1ccc(-c2cc(Cl)ccc2[N+](=O)[O-])cc1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H19ClF2N2O6.C2H6.CH4/c29-20-5-10-24(33(37)38)23(15-20)19-11-12-32(27(35)14-19)25(13-17-1-6-21(30)7-2-17)28(36)39-16-26(34)18-3-8-22(31)9-4-18;1-2;/h1-12,14-15,25H,13,16H2;1-2H3;1H4 |
| InChIKey | NUIJXJDRBTYBCC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 108.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.03 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|