C28H22F2N4O5 — CID 144729157
4-fluoro-N'-[3-(4-fluorophenyl)-2-[4-(5-methyl-2-nitrophenyl)-2-oxo-1-pyridinyl]propanoyl]benzohydrazide (PubChem CID 144729157) has the molecular formula C28H22F2N4O5 and a molecular weight of 532.50 g/mol. Its IUPAC name is 4-fluoro-N'-[3-(4-fluorophenyl)-2-[4-(5-methyl-2-nitrophenyl)-2-oxo-1-pyridinyl]propanoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[3-(4-fluorophenyl)-2-[4-(5-methyl-2-nitrophenyl)-2-oxo-1-pyridinyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 144729157 |
| Molecular Formula | C28H22F2N4O5 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 4-fluoro-N'-[3-(4-fluorophenyl)-2-[4-(5-methyl-2-nitrophenyl)-2-oxo-1-pyridinyl]propanoyl]benzohydrazide |
| SMILES | Cc1ccc([N+](=O)[O-])c(-c2ccn(C(Cc3ccc(F)cc3)C(=O)NNC(=O)c3ccc(F)cc3)c(=O)c2)c1 |
| InChI | InChI=1S/C28H22F2N4O5/c1-17-2-11-24(34(38)39)23(14-17)20-12-13-33(26(35)16-20)25(15-18-3-7-21(29)8-4-18)28(37)32-31-27(36)19-5-9-22(30)10-6-19/h2-14,16,25H,15H2,1H3,(H,31,36)(H,32,37) |
| InChIKey | RREOWRMZKLEMHV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|